C8H16N4O3S — CID 104978522
2-cyclopropyl-2-(cyclopropylsulfamoylamino)-N'-hydroxyethanimidamide (PubChem CID 104978522) has the molecular formula C8H16N4O3S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-cyclopropyl-2-(cyclopropylsulfamoylamino)-N'-hydroxyethanimidamide.
| Compound Name | 2-cyclopropyl-2-(cyclopropylsulfamoylamino)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 104978522 |
| Molecular Formula | C8H16N4O3S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-cyclopropyl-2-(cyclopropylsulfamoylamino)-N'-hydroxyethanimidamide |
| SMILES | NC(=NO)C(NS(=O)(=O)NC1CC1)C1CC1 |
| InChI | InChI=1S/C8H16N4O3S/c9-8(10-13)7(5-1-2-5)12-16(14,15)11-6-3-4-6/h5-7,11-13H,1-4H2,(H2,9,10) |
| InChIKey | AUXDNDAZXKOKET-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|