C6H14N4O3S — CID 104978523
2-cyclopropyl-N'-hydroxy-2-(methylsulfamoylamino)ethanimidamide (PubChem CID 104978523) has the molecular formula C6H14N4O3S and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-cyclopropyl-N'-hydroxy-2-(methylsulfamoylamino)ethanimidamide.
| Compound Name | 2-cyclopropyl-N'-hydroxy-2-(methylsulfamoylamino)ethanimidamide |
|---|---|
| PubChem CID | 104978523 |
| Molecular Formula | C6H14N4O3S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-cyclopropyl-N'-hydroxy-2-(methylsulfamoylamino)ethanimidamide |
| SMILES | CNS(=O)(=O)NC(C(N)=NO)C1CC1 |
| InChI | InChI=1S/C6H14N4O3S/c1-8-14(12,13)10-5(4-2-3-4)6(7)9-11/h4-5,8,10-11H,2-3H2,1H3,(H2,7,9) |
| InChIKey | MHAZXMGKROEOQM-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|