C5H12N4O3S — CID 104985790
2-cyclopropyl-N'-hydroxy-2-(sulfamoylamino)ethanimidamide (PubChem CID 104985790) has the molecular formula C5H12N4O3S and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-cyclopropyl-N'-hydroxy-2-(sulfamoylamino)ethanimidamide.
| Compound Name | 2-cyclopropyl-N'-hydroxy-2-(sulfamoylamino)ethanimidamide |
|---|---|
| PubChem CID | 104985790 |
| Molecular Formula | C5H12N4O3S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 2-cyclopropyl-N'-hydroxy-2-(sulfamoylamino)ethanimidamide |
| SMILES | NC(=NO)C(NS(N)(=O)=O)C1CC1 |
| InChI | InChI=1S/C5H12N4O3S/c6-5(8-10)4(3-1-2-3)9-13(7,11)12/h3-4,9-10H,1-2H2,(H2,6,8)(H2,7,11,12) |
| InChIKey | KNDRLLPMJMDWET-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|