C8H20N4O3S — CID 104978281
N'-hydroxy-2-(propan-2-ylsulfamoylamino)pentanimidamide (PubChem CID 104978281) has the molecular formula C8H20N4O3S and a molecular weight of 252.34 g/mol. Its IUPAC name is N'-hydroxy-2-(propan-2-ylsulfamoylamino)pentanimidamide.
| Compound Name | N'-hydroxy-2-(propan-2-ylsulfamoylamino)pentanimidamide |
|---|---|
| PubChem CID | 104978281 |
| Molecular Formula | C8H20N4O3S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | N'-hydroxy-2-(propan-2-ylsulfamoylamino)pentanimidamide |
| SMILES | CCCC(NS(=O)(=O)NC(C)C)C(N)=NO |
| InChI | InChI=1S/C8H20N4O3S/c1-4-5-7(8(9)10-13)12-16(14,15)11-6(2)3/h6-7,11-13H,4-5H2,1-3H3,(H2,9,10) |
| InChIKey | KHLUYFLPWLNQQP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|