C10H22N4O3S — CID 104978443
2-(tert-butylsulfamoylamino)-N'-hydroxycyclopentane-1-carboximidamide (PubChem CID 104978443) has the molecular formula C10H22N4O3S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-(tert-butylsulfamoylamino)-N'-hydroxycyclopentane-1-carboximidamide.
| Compound Name | 2-(tert-butylsulfamoylamino)-N'-hydroxycyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 104978443 |
| Molecular Formula | C10H22N4O3S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-(tert-butylsulfamoylamino)-N'-hydroxycyclopentane-1-carboximidamide |
| SMILES | CC(C)(C)NS(=O)(=O)NC1CCCC1C(N)=NO |
| InChI | InChI=1S/C10H22N4O3S/c1-10(2,3)14-18(16,17)13-8-6-4-5-7(8)9(11)12-15/h7-8,13-15H,4-6H2,1-3H3,(H2,11,12) |
| InChIKey | AUGXDYZXODCCBM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|