C11H11ClFNO3 — CID 104980082
(3S)-3-acetamido-3-(4-chloro-2-fluorophenyl)propanoic acid (PubChem CID 104980082) has the molecular formula C11H11ClFNO3 and a molecular weight of 259.66 g/mol. Its IUPAC name is (3S)-3-acetamido-3-(4-chloro-2-fluorophenyl)propanoic acid.
| Compound Name | (3S)-3-acetamido-3-(4-chloro-2-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 104980082 |
| Molecular Formula | C11H11ClFNO3 |
| Molecular Weight | 259.66 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | (3S)-3-acetamido-3-(4-chloro-2-fluorophenyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H11ClFNO3/c1-6(15)14-10(5-11(16)17)8-3-2-7(12)4-9(8)13/h2-4,10H,5H2,1H3,(H,14,15)(H,16,17)/t10-/m0/s1 |
| InChIKey | CKCXUJXFTDSEHD-JTQLQIEISA-N |
| XLogP | 2.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.66 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |