C20H26NO3P — CID 10498668
(3S,5R)-4-benzyl-2-methoxy-5-phenyl-3-propyl-1,4,2λ5-oxazaphosphinane 2-oxide (PubChem CID 10498668) has the molecular formula C20H26NO3P and a molecular weight of 359.41 g/mol. Its IUPAC name is (3S,5R)-4-benzyl-2-methoxy-5-phenyl-3-propyl-1,4,2λ5-oxazaphosphinane 2-oxide.
| Compound Name | (3S,5R)-4-benzyl-2-methoxy-5-phenyl-3-propyl-1,4,2λ5-oxazaphosphinane 2-oxide |
|---|---|
| PubChem CID | 10498668 |
| Molecular Formula | C20H26NO3P |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3S,5R)-4-benzyl-2-methoxy-5-phenyl-3-propyl-1,4,2λ5-oxazaphosphinane 2-oxide |
| SMILES | CCC[C@H]1N(Cc2ccccc2)[C@H](c2ccccc2)COP1(=O)OC |
| InChI | InChI=1S/C20H26NO3P/c1-3-10-20-21(15-17-11-6-4-7-12-17)19(16-24-25(20,22)23-2)18-13-8-5-9-14-18/h4-9,11-14,19-20H,3,10,15-16H2,1-2H3/t19-,20-,25?/m0/s1 |
| InChIKey | HOZOJWQMNXUGLZ-QGGGIAGFSA-N |
| XLogP | 5.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|