C21H29FN3O3P — CID 11048088
N-[[(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine (PubChem CID 11048088) has the molecular formula C21H29FN3O3P and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[[(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine.
| Compound Name | N-[[(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine |
|---|---|
| PubChem CID | 11048088 |
| Molecular Formula | C21H29FN3O3P |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | N-[[(2S,3S)-4-benzyl-3-(4-fluorophenyl)morpholin-2-yl]oxy-(dimethylamino)phosphoryl]-N-methylmethanamine |
| SMILES | CN(C)P(=O)(O[C@@H]1OCCN(Cc2ccccc2)[C@H]1c1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C21H29FN3O3P/c1-23(2)29(26,24(3)4)28-21-20(18-10-12-19(22)13-11-18)25(14-15-27-21)16-17-8-6-5-7-9-17/h5-13,20-21H,14-16H2,1-4H3/t20-,21-/m0/s1 |
| InChIKey | BHPCOYRSCYWGBW-SFTDATJTSA-N |
| XLogP | 3.97 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|