C18H20FNO2 — CID 11833536
(2S,3R)-3-(4-fluorophenyl)-4-[(1R)-1-phenylethyl]morpholin-2-ol (PubChem CID 11833536) has the molecular formula C18H20FNO2 and a molecular weight of 301.36 g/mol. Its IUPAC name is (2S,3R)-3-(4-fluorophenyl)-4-[(1R)-1-phenylethyl]morpholin-2-ol.
| Compound Name | (2S,3R)-3-(4-fluorophenyl)-4-[(1R)-1-phenylethyl]morpholin-2-ol |
|---|---|
| PubChem CID | 11833536 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2S,3R)-3-(4-fluorophenyl)-4-[(1R)-1-phenylethyl]morpholin-2-ol |
| SMILES | C[C@H](c1ccccc1)N1CCO[C@H](O)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNO2/c1-13(14-5-3-2-4-6-14)20-11-12-22-18(21)17(20)15-7-9-16(19)10-8-15/h2-10,13,17-18,21H,11-12H2,1H3/t13-,17-,18+/m1/s1 |
| InChIKey | GDADHSAHTCURBH-XWIAVFTESA-N |
| XLogP | 3.28 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |