C25H28FNO — CID 53343017
(1S,2R)-1-(dibenzylamino)-3-fluoro-3-methyl-1-phenylbutan-2-ol (PubChem CID 53343017) has the molecular formula C25H28FNO and a molecular weight of 377.50 g/mol. Its IUPAC name is (1S,2R)-1-(dibenzylamino)-3-fluoro-3-methyl-1-phenylbutan-2-ol.
| Compound Name | (1S,2R)-1-(dibenzylamino)-3-fluoro-3-methyl-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 53343017 |
| Molecular Formula | C25H28FNO |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (1S,2R)-1-(dibenzylamino)-3-fluoro-3-methyl-1-phenylbutan-2-ol |
| SMILES | CC(C)(F)[C@H](O)[C@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H28FNO/c1-25(2,26)24(28)23(22-16-10-5-11-17-22)27(18-20-12-6-3-7-13-20)19-21-14-8-4-9-15-21/h3-17,23-24,28H,18-19H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | OTBSYWJIQBTASH-BJKOFHAPSA-N |
| XLogP | 5.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |