C27H29NO — CID 11740693
(1R,2S)-2-[methyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)ethyl]amino]-1-phenylpropan-1-ol (PubChem CID 11740693) has the molecular formula C27H29NO and a molecular weight of 383.54 g/mol. Its IUPAC name is (1R,2S)-2-[methyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)ethyl]amino]-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-[methyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)ethyl]amino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 11740693 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (1R,2S)-2-[methyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)ethyl]amino]-1-phenylpropan-1-ol |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)CC=C1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C27H29NO/c1-20(27(29)23-12-4-3-5-13-23)28(2)19-18-26-24-14-8-6-10-21(24)16-17-22-11-7-9-15-25(22)26/h3-15,18,20,27,29H,16-17,19H2,1-2H3/t20-,27-/m0/s1 |
| InChIKey | BHVGOYREXHCFOE-DCFHFQCYSA-N |
| XLogP | 5.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|