C24H30ClNO2 — CID 70560139
5-(dimethylamino)-7-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)heptanoic acid;hydrochloride (PubChem CID 70560139) has the molecular formula C24H30ClNO2 and a molecular weight of 399.96 g/mol. Its IUPAC name is 5-(dimethylamino)-7-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)heptanoic acid;hydrochloride.
| Compound Name | 5-(dimethylamino)-7-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)heptanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70560139 |
| Molecular Formula | C24H30ClNO2 |
| Molecular Weight | 399.96 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 5-(dimethylamino)-7-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)heptanoic acid;hydrochloride |
| SMILES | CN(C)C(CC=C1c2ccccc2CCc2ccccc21)CCCC(=O)O.Cl |
| InChI | InChI=1S/C24H29NO2.ClH/c1-25(2)20(10-7-13-24(26)27)16-17-23-21-11-5-3-8-18(21)14-15-19-9-4-6-12-22(19)23;/h3-6,8-9,11-12,17,20H,7,10,13-16H2,1-2H3,(H,26,27);1H |
| InChIKey | NOYMKCSWAMDPAA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.96 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|