C16H22F3N — CID 104987546
N-propyl-1-[4-(trifluoromethyl)phenyl]hex-5-en-2-amine (PubChem CID 104987546) has the molecular formula C16H22F3N and a molecular weight of 285.35 g/mol. Its IUPAC name is N-propyl-1-[4-(trifluoromethyl)phenyl]hex-5-en-2-amine.
| Compound Name | N-propyl-1-[4-(trifluoromethyl)phenyl]hex-5-en-2-amine |
|---|---|
| PubChem CID | 104987546 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-propyl-1-[4-(trifluoromethyl)phenyl]hex-5-en-2-amine |
| SMILES | C=CCCC(Cc1ccc(C(F)(F)F)cc1)NCCC |
| InChI | InChI=1S/C16H22F3N/c1-3-5-6-15(20-11-4-2)12-13-7-9-14(10-8-13)16(17,18)19/h3,7-10,15,20H,1,4-6,11-12H2,2H3 |
| InChIKey | SOQUQEBENVXSBZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|