C16H21NS2 — CID 104991415
N-[(2-methylsulfanylphenyl)-(5-methylthiophen-3-yl)methyl]propan-1-amine (PubChem CID 104991415) has the molecular formula C16H21NS2 and a molecular weight of 291.49 g/mol. Its IUPAC name is N-[(2-methylsulfanylphenyl)-(5-methylthiophen-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-methylsulfanylphenyl)-(5-methylthiophen-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 104991415 |
| Molecular Formula | C16H21NS2 |
| Molecular Weight | 291.49 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[(2-methylsulfanylphenyl)-(5-methylthiophen-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1csc(C)c1)c1ccccc1SC |
| InChI | InChI=1S/C16H21NS2/c1-4-9-17-16(13-10-12(2)19-11-13)14-7-5-6-8-15(14)18-3/h5-8,10-11,16-17H,4,9H2,1-3H3 |
| InChIKey | KUYCRRNNPOMSAP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |