C17H20ClNS — CID 115801336
N-[(2-chlorophenyl)-(2-methylsulfanylphenyl)methyl]propan-1-amine (PubChem CID 115801336) has the molecular formula C17H20ClNS and a molecular weight of 305.87 g/mol. Its IUPAC name is N-[(2-chlorophenyl)-(2-methylsulfanylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(2-chlorophenyl)-(2-methylsulfanylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115801336 |
| Molecular Formula | C17H20ClNS |
| Molecular Weight | 305.87 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[(2-chlorophenyl)-(2-methylsulfanylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccccc1Cl)c1ccccc1SC |
| InChI | InChI=1S/C17H20ClNS/c1-3-12-19-17(13-8-4-6-10-15(13)18)14-9-5-7-11-16(14)20-2/h4-11,17,19H,3,12H2,1-2H3 |
| InChIKey | WYLQGZWPYSQYKO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.87 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |