C17H19BrN2O3 — CID 1049923
4-bromo-N-[1-(4,4-dimethyl-2,6-dioxocyclohexyl)ethylideneamino]benzamide (PubChem CID 1049923) has the molecular formula C17H19BrN2O3 and a molecular weight of 379.25 g/mol. Its IUPAC name is 4-bromo-N-[1-(4,4-dimethyl-2,6-dioxocyclohexyl)ethylideneamino]benzamide.
| Compound Name | 4-bromo-N-[1-(4,4-dimethyl-2,6-dioxocyclohexyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 1049923 |
| Molecular Formula | C17H19BrN2O3 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 4-bromo-N-[1-(4,4-dimethyl-2,6-dioxocyclohexyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(Br)cc1)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C17H19BrN2O3/c1-10(15-13(21)8-17(2,3)9-14(15)22)19-20-16(23)11-4-6-12(18)7-5-11/h4-7,15H,8-9H2,1-3H3,(H,20,23) |
| InChIKey | JSRMKZZLPNQQEI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|