C14H26F3N — CID 104992726
1-cyclopentyl-6,6,6-trifluoro-N-propylhexan-3-amine (PubChem CID 104992726) has the molecular formula C14H26F3N and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-cyclopentyl-6,6,6-trifluoro-N-propylhexan-3-amine.
| Compound Name | 1-cyclopentyl-6,6,6-trifluoro-N-propylhexan-3-amine |
|---|---|
| PubChem CID | 104992726 |
| Molecular Formula | C14H26F3N |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 1-cyclopentyl-6,6,6-trifluoro-N-propylhexan-3-amine |
| SMILES | CCCNC(CCC1CCCC1)CCC(F)(F)F |
| InChI | InChI=1S/C14H26F3N/c1-2-11-18-13(9-10-14(15,16)17)8-7-12-5-3-4-6-12/h12-13,18H,2-11H2,1H3 |
| InChIKey | KVXNNALSWQOUDM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |