C18H37N — CID 115849970
1-cyclohexyl-6,6-dimethyl-N-propylheptan-3-amine (PubChem CID 115849970) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is 1-cyclohexyl-6,6-dimethyl-N-propylheptan-3-amine.
| Compound Name | 1-cyclohexyl-6,6-dimethyl-N-propylheptan-3-amine |
|---|---|
| PubChem CID | 115849970 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | 1-cyclohexyl-6,6-dimethyl-N-propylheptan-3-amine |
| SMILES | CCCNC(CCC1CCCCC1)CCC(C)(C)C |
| InChI | InChI=1S/C18H37N/c1-5-15-19-17(13-14-18(2,3)4)12-11-16-9-7-6-8-10-16/h16-17,19H,5-15H2,1-4H3 |
| InChIKey | GRPAVHKMHQCPBP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |