C24H23N3O — CID 10499342
1-[(E)-1-ethoxy-3,4-diphenylbut-1-enyl]benzotriazole (PubChem CID 10499342) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[(E)-1-ethoxy-3,4-diphenylbut-1-enyl]benzotriazole.
| Compound Name | 1-[(E)-1-ethoxy-3,4-diphenylbut-1-enyl]benzotriazole |
|---|---|
| PubChem CID | 10499342 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 1-[(E)-1-ethoxy-3,4-diphenylbut-1-enyl]benzotriazole |
| SMILES | CCO/C(=C/C(Cc1ccccc1)c1ccccc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C24H23N3O/c1-2-28-24(27-23-16-10-9-15-22(23)25-26-27)18-21(20-13-7-4-8-14-20)17-19-11-5-3-6-12-19/h3-16,18,21H,2,17H2,1H3/b24-18+ |
| InChIKey | GGNCCEZRFLVHCC-HKOYGPOVSA-N |
| XLogP | 5.29 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|