C16H19BrFN3 — CID 104994013
1-(2-bromo-3-fluorophenyl)-2-(1-cyclopentylpyrazol-3-yl)ethanamine (PubChem CID 104994013) has the molecular formula C16H19BrFN3 and a molecular weight of 352.25 g/mol. Its IUPAC name is 1-(2-bromo-3-fluorophenyl)-2-(1-cyclopentylpyrazol-3-yl)ethanamine.
| Compound Name | 1-(2-bromo-3-fluorophenyl)-2-(1-cyclopentylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104994013 |
| Molecular Formula | C16H19BrFN3 |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-(2-bromo-3-fluorophenyl)-2-(1-cyclopentylpyrazol-3-yl)ethanamine |
| SMILES | NC(Cc1ccn(C2CCCC2)n1)c1cccc(F)c1Br |
| InChI | InChI=1S/C16H19BrFN3/c17-16-13(6-3-7-14(16)18)15(19)10-11-8-9-21(20-11)12-4-1-2-5-12/h3,6-9,12,15H,1-2,4-5,10,19H2 |
| InChIKey | BDQUZQPTFMSWRW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |