C16H19Cl2N3 — CID 104994021
2-(1-cyclopentylpyrazol-3-yl)-1-(2,3-dichlorophenyl)ethanamine (PubChem CID 104994021) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.26 g/mol. Its IUPAC name is 2-(1-cyclopentylpyrazol-3-yl)-1-(2,3-dichlorophenyl)ethanamine.
| Compound Name | 2-(1-cyclopentylpyrazol-3-yl)-1-(2,3-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 104994021 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-(1-cyclopentylpyrazol-3-yl)-1-(2,3-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1ccn(C2CCCC2)n1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H19Cl2N3/c17-14-7-3-6-13(16(14)18)15(19)10-11-8-9-21(20-11)12-4-1-2-5-12/h3,6-9,12,15H,1-2,4-5,10,19H2 |
| InChIKey | UNRQYBQCBQVUJK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |