C16H18ClFN2O — CID 64785666
1-(3-chloro-2-fluorophenyl)-2-(1-cyclopentylpyrazol-3-yl)ethanol (PubChem CID 64785666) has the molecular formula C16H18ClFN2O and a molecular weight of 308.78 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-2-(1-cyclopentylpyrazol-3-yl)ethanol.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-2-(1-cyclopentylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 64785666 |
| Molecular Formula | C16H18ClFN2O |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-2-(1-cyclopentylpyrazol-3-yl)ethanol |
| SMILES | OC(Cc1ccn(C2CCCC2)n1)c1cccc(Cl)c1F |
| InChI | InChI=1S/C16H18ClFN2O/c17-14-7-3-6-13(16(14)18)15(21)10-11-8-9-20(19-11)12-4-1-2-5-12/h3,6-9,12,15,21H,1-2,4-5,10H2 |
| InChIKey | ZIVDEUQWTKQFPX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |