C14H17BrN2O2 — CID 106859308
1-(2-bromofuran-3-yl)-2-(1-cyclopentylpyrazol-3-yl)ethanol (PubChem CID 106859308) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-2-(1-cyclopentylpyrazol-3-yl)ethanol.
| Compound Name | 1-(2-bromofuran-3-yl)-2-(1-cyclopentylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 106859308 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-2-(1-cyclopentylpyrazol-3-yl)ethanol |
| SMILES | OC(Cc1ccn(C2CCCC2)n1)c1ccoc1Br |
| InChI | InChI=1S/C14H17BrN2O2/c15-14-12(6-8-19-14)13(18)9-10-5-7-17(16-10)11-3-1-2-4-11/h5-8,11,13,18H,1-4,9H2 |
| InChIKey | OAQGVQBGECWHBB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |