C17H33N3 — CID 104996074
1-(2,5-dimethylpyrazol-3-yl)-3-ethyl-N-propylheptan-2-amine (PubChem CID 104996074) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-3-ethyl-N-propylheptan-2-amine.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-3-ethyl-N-propylheptan-2-amine |
|---|---|
| PubChem CID | 104996074 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-3-ethyl-N-propylheptan-2-amine |
| SMILES | CCCCC(CC)C(Cc1cc(C)nn1C)NCCC |
| InChI | InChI=1S/C17H33N3/c1-6-9-10-15(8-3)17(18-11-7-2)13-16-12-14(4)19-20(16)5/h12,15,17-18H,6-11,13H2,1-5H3 |
| InChIKey | ZTXSVCNKXXQKIZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |