C26H36N2 — CID 10499793
1-N-[7-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]heptyl]-2-N-phenylbenzene-1,2-diamine (PubChem CID 10499793) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 1-N-[7-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]heptyl]-2-N-phenylbenzene-1,2-diamine.
| Compound Name | 1-N-[7-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]heptyl]-2-N-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 10499793 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 1-N-[7-[(1R,4S)-2-bicyclo[2.2.1]heptanyl]heptyl]-2-N-phenylbenzene-1,2-diamine |
| SMILES | c1ccc(Nc2ccccc2NCCCCCCCC2C[C@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C26H36N2/c1(2-5-11-22-19-21-16-17-23(22)20-21)3-10-18-27-25-14-8-9-15-26(25)28-24-12-6-4-7-13-24/h4,6-9,12-15,21-23,27-28H,1-3,5,10-11,16-20H2/t21-,22?,23-/m1/s1 |
| InChIKey | TWDVLJDJVJTTDV-OJVMETQDSA-N |
| XLogP | 7.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|