C14H27N — CID 105000647
N-ethyl-1-[1-(2-methylpropyl)cyclopentyl]prop-2-en-1-amine (PubChem CID 105000647) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is N-ethyl-1-[1-(2-methylpropyl)cyclopentyl]prop-2-en-1-amine.
| Compound Name | N-ethyl-1-[1-(2-methylpropyl)cyclopentyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 105000647 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | N-ethyl-1-[1-(2-methylpropyl)cyclopentyl]prop-2-en-1-amine |
| SMILES | C=CC(NCC)C1(CC(C)C)CCCC1 |
| InChI | InChI=1S/C14H27N/c1-5-13(15-6-2)14(11-12(3)4)9-7-8-10-14/h5,12-13,15H,1,6-11H2,2-4H3 |
| InChIKey | PEXYRDKRSFDBOT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|