C13H27N — CID 115779478
N-ethyl-1-[1-(2-methylpropyl)cyclopentyl]ethanamine (PubChem CID 115779478) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is N-ethyl-1-[1-(2-methylpropyl)cyclopentyl]ethanamine.
| Compound Name | N-ethyl-1-[1-(2-methylpropyl)cyclopentyl]ethanamine |
|---|---|
| PubChem CID | 115779478 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-ethyl-1-[1-(2-methylpropyl)cyclopentyl]ethanamine |
| SMILES | CCNC(C)C1(CC(C)C)CCCC1 |
| InChI | InChI=1S/C13H27N/c1-5-14-12(4)13(10-11(2)3)8-6-7-9-13/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | VVSOISRNUURRAK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |