C13H18BrN — CID 105000814
1-(4-bromo-2-methylphenyl)-N-propylprop-2-en-1-amine (PubChem CID 105000814) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)-N-propylprop-2-en-1-amine.
| Compound Name | 1-(4-bromo-2-methylphenyl)-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105000814 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)-N-propylprop-2-en-1-amine |
| SMILES | C=CC(NCCC)c1ccc(Br)cc1C |
| InChI | InChI=1S/C13H18BrN/c1-4-8-15-13(5-2)12-7-6-11(14)9-10(12)3/h5-7,9,13,15H,2,4,8H2,1,3H3 |
| InChIKey | MNFFYFIGZJMSEZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|