C17H24IN3 — CID 105001727
2-(1,3-diethylpyrazol-5-yl)-N-ethyl-1-(3-iodophenyl)ethanamine (PubChem CID 105001727) has the molecular formula C17H24IN3 and a molecular weight of 397.30 g/mol. Its IUPAC name is 2-(1,3-diethylpyrazol-5-yl)-N-ethyl-1-(3-iodophenyl)ethanamine.
| Compound Name | 2-(1,3-diethylpyrazol-5-yl)-N-ethyl-1-(3-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 105001727 |
| Molecular Formula | C17H24IN3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-(1,3-diethylpyrazol-5-yl)-N-ethyl-1-(3-iodophenyl)ethanamine |
| SMILES | CCNC(Cc1cc(CC)nn1CC)c1cccc(I)c1 |
| InChI | InChI=1S/C17H24IN3/c1-4-15-11-16(21(6-3)20-15)12-17(19-5-2)13-8-7-9-14(18)10-13/h7-11,17,19H,4-6,12H2,1-3H3 |
| InChIKey | ROCYZNYQBRHGJP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|