C16H16Cl2IN — CID 63528155
2-(3,4-dichlorophenyl)-N-ethyl-1-(3-iodophenyl)ethanamine (PubChem CID 63528155) has the molecular formula C16H16Cl2IN and a molecular weight of 420.12 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-ethyl-1-(3-iodophenyl)ethanamine.
| Compound Name | 2-(3,4-dichlorophenyl)-N-ethyl-1-(3-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 63528155 |
| Molecular Formula | C16H16Cl2IN |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-ethyl-1-(3-iodophenyl)ethanamine |
| SMILES | CCNC(Cc1ccc(Cl)c(Cl)c1)c1cccc(I)c1 |
| InChI | InChI=1S/C16H16Cl2IN/c1-2-20-16(12-4-3-5-13(19)10-12)9-11-6-7-14(17)15(18)8-11/h3-8,10,16,20H,2,9H2,1H3 |
| InChIKey | SWHPJBBMADHVAY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|