C13H15ClF2N4 — CID 105001989
1-(4-chloro-2,5-difluorophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)-N-methylethanamine (PubChem CID 105001989) has the molecular formula C13H15ClF2N4 and a molecular weight of 300.74 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)-N-methylethanamine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105001989 |
| Molecular Formula | C13H15ClF2N4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(2-ethyl-1,2,4-triazol-3-yl)-N-methylethanamine |
| SMILES | CCn1ncnc1CC(NC)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H15ClF2N4/c1-3-20-13(18-7-19-20)6-12(17-2)8-4-11(16)9(14)5-10(8)15/h4-5,7,12,17H,3,6H2,1-2H3 |
| InChIKey | LSLVBWHNCULCJD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|