C14H15Cl2F2N3 — CID 105034948
1-(4-chloro-2,5-difluorophenyl)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-methylethanamine (PubChem CID 105034948) has the molecular formula C14H15Cl2F2N3 and a molecular weight of 334.20 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-methylethanamine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105034948 |
| Molecular Formula | C14H15Cl2F2N3 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-methylethanamine |
| SMILES | CNC(Cc1c(C)nn(C)c1Cl)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H15Cl2F2N3/c1-7-8(14(16)21(3)20-7)5-13(19-2)9-4-12(18)10(15)6-11(9)17/h4,6,13,19H,5H2,1-3H3 |
| InChIKey | VFJSQEFSSQXXTB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|