C19H28O8 — CID 10500223
(E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-en-1-one (PubChem CID 10500223) has the molecular formula C19H28O8 and a molecular weight of 384.43 g/mol. Its IUPAC name is (E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10500223 |
| Molecular Formula | C19H28O8 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (E)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-en-1-one |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](/C=C/C(=O)[C@H]1COC(C)(C)O1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C19H28O8/c1-17(2)21-9-12(23-17)10(20)7-8-11-13-14(25-18(3,4)24-13)15-16(22-11)27-19(5,6)26-15/h7-8,11-16H,9H2,1-6H3/b8-7+/t11-,12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | MFXYDZUXDWRDBN-BMEKQQCTSA-N |
| XLogP | 1.66 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|