C12H16BrN — CID 105004288
1-(2-bromo-4-methylphenyl)-3-methylbut-3-en-1-amine (PubChem CID 105004288) has the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-3-methylbut-3-en-1-amine.
| Compound Name | 1-(2-bromo-4-methylphenyl)-3-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 105004288 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-3-methylbut-3-en-1-amine |
| SMILES | C=C(C)CC(N)c1ccc(C)cc1Br |
| InChI | InChI=1S/C12H16BrN/c1-8(2)6-12(14)10-5-4-9(3)7-11(10)13/h4-5,7,12H,1,6,14H2,2-3H3 |
| InChIKey | BUZIDNWHGSRPKI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|