C11H15BrClNO — CID 171203537
3-[(1R)-1-amino-3-methylbut-3-enyl]-4-bromophenol;hydrochloride (PubChem CID 171203537) has the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3-methylbut-3-enyl]-4-bromophenol;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-3-methylbut-3-enyl]-4-bromophenol;hydrochloride |
|---|---|
| PubChem CID | 171203537 |
| Molecular Formula | C11H15BrClNO |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 3-[(1R)-1-amino-3-methylbut-3-enyl]-4-bromophenol;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1cc(O)ccc1Br.Cl |
| InChI | InChI=1S/C11H14BrNO.ClH/c1-7(2)5-11(13)9-6-8(14)3-4-10(9)12;/h3-4,6,11,14H,1,5,13H2,2H3;1H/t11-;/m1./s1 |
| InChIKey | ZCHZFSZAKFVIDR-RFVHGSKJSA-N |
| XLogP | 3.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|