C18H24FeN2O4+2 — CID 10500453
CID 10500453 (PubChem CID 10500453) has the molecular formula C18H24FeN2O4+2 and a molecular weight of 388.25 g/mol.
| Compound Name | CID 10500453 |
|---|---|
| PubChem CID | 10500453 |
| Molecular Formula | C18H24FeN2O4+2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | — |
| SMILES | COC(=O)C[C@@H](N)[C]1[CH][CH][CH][CH]1.COC(=O)C[C@@H](N)[C]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/2C9H12NO2.Fe/c2*1-12-9(11)6-8(10)7-4-2-3-5-7;/h2*2-5,8H,6,10H2,1H3;/q;;+2/t2*8-;/m11./s1 |
| InChIKey | NZJCCLBAFMMHMG-GGTCEIRZSA-N |
| XLogP | 0.56 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|