C16H29N — CID 105004806
1-(2-bicyclo[2.2.1]heptanyl)-4-methyl-N-propylpent-3-en-2-amine (PubChem CID 105004806) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-4-methyl-N-propylpent-3-en-2-amine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-methyl-N-propylpent-3-en-2-amine |
|---|---|
| PubChem CID | 105004806 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-4-methyl-N-propylpent-3-en-2-amine |
| SMILES | CCCNC(C=C(C)C)CC1CC2CCC1C2 |
| InChI | InChI=1S/C16H29N/c1-4-7-17-16(8-12(2)3)11-15-10-13-5-6-14(15)9-13/h8,13-17H,4-7,9-11H2,1-3H3 |
| InChIKey | UOFLRGHAIPOJJX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|