C18H35NO — CID 116759433
1-(2-bicyclo[2.2.1]heptanyl)-3-ethoxy-3-methyl-N-propylpentan-2-amine (PubChem CID 116759433) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3-ethoxy-3-methyl-N-propylpentan-2-amine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-ethoxy-3-methyl-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 116759433 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-ethoxy-3-methyl-N-propylpentan-2-amine |
| SMILES | CCCNC(CC1CC2CCC1C2)C(C)(CC)OCC |
| InChI | InChI=1S/C18H35NO/c1-5-10-19-17(18(4,6-2)20-7-3)13-16-12-14-8-9-15(16)11-14/h14-17,19H,5-13H2,1-4H3 |
| InChIKey | ARXGMVQPMGOOGB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |