C16H17ClINO — CID 105006994
N-[(4-chloro-3-methoxyphenyl)-(2-iodophenyl)methyl]ethanamine (PubChem CID 105006994) has the molecular formula C16H17ClINO and a molecular weight of 401.68 g/mol. Its IUPAC name is N-[(4-chloro-3-methoxyphenyl)-(2-iodophenyl)methyl]ethanamine.
| Compound Name | N-[(4-chloro-3-methoxyphenyl)-(2-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105006994 |
| Molecular Formula | C16H17ClINO |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | N-[(4-chloro-3-methoxyphenyl)-(2-iodophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Cl)c(OC)c1)c1ccccc1I |
| InChI | InChI=1S/C16H17ClINO/c1-3-19-16(12-6-4-5-7-14(12)18)11-8-9-13(17)15(10-11)20-2/h4-10,16,19H,3H2,1-2H3 |
| InChIKey | MDLBTGIYQJSSKE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|