C17H20INO2 — CID 43489510
N-[(2,5-dimethoxyphenyl)-(2-iodophenyl)methyl]ethanamine (PubChem CID 43489510) has the molecular formula C17H20INO2 and a molecular weight of 397.26 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)-(2-iodophenyl)methyl]ethanamine.
| Compound Name | N-[(2,5-dimethoxyphenyl)-(2-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43489510 |
| Molecular Formula | C17H20INO2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)-(2-iodophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccccc1I)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H20INO2/c1-4-19-17(13-7-5-6-8-15(13)18)14-11-12(20-2)9-10-16(14)21-3/h5-11,17,19H,4H2,1-3H3 |
| InChIKey | TYWOQFXNXJMYOO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|