C12H18BrNO — CID 105007883
1-(3-bromo-2-methylphenyl)-2-ethoxy-N-methylethanamine (PubChem CID 105007883) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 1-(3-bromo-2-methylphenyl)-2-ethoxy-N-methylethanamine.
| Compound Name | 1-(3-bromo-2-methylphenyl)-2-ethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 105007883 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-(3-bromo-2-methylphenyl)-2-ethoxy-N-methylethanamine |
| SMILES | CCOCC(NC)c1cccc(Br)c1C |
| InChI | InChI=1S/C12H18BrNO/c1-4-15-8-12(14-3)10-6-5-7-11(13)9(10)2/h5-7,12,14H,4,8H2,1-3H3 |
| InChIKey | PBLKFVRJSZOVAA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |