C13H18BrN — CID 104987320
1-(3-bromo-2-methylphenyl)-N-methylpent-4-en-1-amine (PubChem CID 104987320) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 1-(3-bromo-2-methylphenyl)-N-methylpent-4-en-1-amine.
| Compound Name | 1-(3-bromo-2-methylphenyl)-N-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 104987320 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(3-bromo-2-methylphenyl)-N-methylpent-4-en-1-amine |
| SMILES | C=CCCC(NC)c1cccc(Br)c1C |
| InChI | InChI=1S/C13H18BrN/c1-4-5-9-13(15-3)11-7-6-8-12(14)10(11)2/h4,6-8,13,15H,1,5,9H2,2-3H3 |
| InChIKey | HCPHSOXHNMDVQC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|