C10H14BrNS — CID 104987232
1-(3-bromothiophen-2-yl)-N-methylpent-4-en-1-amine (PubChem CID 104987232) has the molecular formula C10H14BrNS and a molecular weight of 260.20 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N-methylpent-4-en-1-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 104987232 |
| Molecular Formula | C10H14BrNS |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N-methylpent-4-en-1-amine |
| SMILES | C=CCCC(NC)c1sccc1Br |
| InChI | InChI=1S/C10H14BrNS/c1-3-4-5-9(12-2)10-8(11)6-7-13-10/h3,6-7,9,12H,1,4-5H2,2H3 |
| InChIKey | JMHTVPQAMUMZHH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|