C9H14BrNO2S2 — CID 115848103
1-(3-bromothiophen-2-yl)-N-methyl-3-methylsulfonylpropan-1-amine (PubChem CID 115848103) has the molecular formula C9H14BrNO2S2 and a molecular weight of 312.25 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N-methyl-3-methylsulfonylpropan-1-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N-methyl-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 115848103 |
| Molecular Formula | C9H14BrNO2S2 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N-methyl-3-methylsulfonylpropan-1-amine |
| SMILES | CNC(CCS(C)(=O)=O)c1sccc1Br |
| InChI | InChI=1S/C9H14BrNO2S2/c1-11-8(4-6-15(2,12)13)9-7(10)3-5-14-9/h3,5,8,11H,4,6H2,1-2H3 |
| InChIKey | PEXWFYCXBOOYJS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |