C7H10BrNO2S2 — CID 130055235
(1R)-1-(3-bromothiophen-2-yl)-2-methylsulfonylethanamine (PubChem CID 130055235) has the molecular formula C7H10BrNO2S2 and a molecular weight of 284.20 g/mol. Its IUPAC name is (1R)-1-(3-bromothiophen-2-yl)-2-methylsulfonylethanamine.
| Compound Name | (1R)-1-(3-bromothiophen-2-yl)-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 130055235 |
| Molecular Formula | C7H10BrNO2S2 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 282.93 |
| IUPAC Name | (1R)-1-(3-bromothiophen-2-yl)-2-methylsulfonylethanamine |
| SMILES | CS(=O)(=O)C[C@@H](N)c1sccc1Br |
| InChI | InChI=1S/C7H10BrNO2S2/c1-13(10,11)4-6(9)7-5(8)2-3-12-7/h2-3,6H,4,9H2,1H3/t6-/m1/s1 |
| InChIKey | LREJHFMQACFCLK-ZCFIWIBFSA-N |
| XLogP | 1.55 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |