C14H20ClN — CID 107102445
1-(3-chloro-2-methylphenyl)-N-methylhex-5-en-1-amine (PubChem CID 107102445) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-N-methylhex-5-en-1-amine.
| Compound Name | 1-(3-chloro-2-methylphenyl)-N-methylhex-5-en-1-amine |
|---|---|
| PubChem CID | 107102445 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-N-methylhex-5-en-1-amine |
| SMILES | C=CCCCC(NC)c1cccc(Cl)c1C |
| InChI | InChI=1S/C14H20ClN/c1-4-5-6-10-14(16-3)12-8-7-9-13(15)11(12)2/h4,7-9,14,16H,1,5-6,10H2,2-3H3 |
| InChIKey | WDXRAEGJENKXGM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|