C19H33NO — CID 105010294
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(5-oxaspiro[3.5]nonan-8-yl)methanamine (PubChem CID 105010294) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(5-oxaspiro[3.5]nonan-8-yl)methanamine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(5-oxaspiro[3.5]nonan-8-yl)methanamine |
|---|---|
| PubChem CID | 105010294 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl(5-oxaspiro[3.5]nonan-8-yl)methanamine |
| SMILES | NC(C1CCC2CCCCC2C1)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C19H33NO/c20-18(17-8-11-21-19(13-17)9-3-10-19)16-7-6-14-4-1-2-5-15(14)12-16/h14-18H,1-13,20H2 |
| InChIKey | RBSWKLZNZXFKRM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |