C15H18BrNOS — CID 105010666
N-[(4-bromothiophen-3-yl)-(3-methoxy-4-methylphenyl)methyl]ethanamine (PubChem CID 105010666) has the molecular formula C15H18BrNOS and a molecular weight of 340.29 g/mol. Its IUPAC name is N-[(4-bromothiophen-3-yl)-(3-methoxy-4-methylphenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromothiophen-3-yl)-(3-methoxy-4-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105010666 |
| Molecular Formula | C15H18BrNOS |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-[(4-bromothiophen-3-yl)-(3-methoxy-4-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(C)c(OC)c1)c1cscc1Br |
| InChI | InChI=1S/C15H18BrNOS/c1-4-17-15(12-8-19-9-13(12)16)11-6-5-10(2)14(7-11)18-3/h5-9,15,17H,4H2,1-3H3 |
| InChIKey | SJKAYCRGKJSBCY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |