C12H12BrFN2OS — CID 105322605
[(4-bromothiophen-3-yl)-(4-fluoro-3-methoxyphenyl)methyl]hydrazine (PubChem CID 105322605) has the molecular formula C12H12BrFN2OS and a molecular weight of 331.21 g/mol. Its IUPAC name is [(4-bromothiophen-3-yl)-(4-fluoro-3-methoxyphenyl)methyl]hydrazine.
| Compound Name | [(4-bromothiophen-3-yl)-(4-fluoro-3-methoxyphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105322605 |
| Molecular Formula | C12H12BrFN2OS |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | [(4-bromothiophen-3-yl)-(4-fluoro-3-methoxyphenyl)methyl]hydrazine |
| SMILES | COc1cc(C(NN)c2cscc2Br)ccc1F |
| InChI | InChI=1S/C12H12BrFN2OS/c1-17-11-4-7(2-3-10(11)14)12(16-15)8-5-18-6-9(8)13/h2-6,12,16H,15H2,1H3 |
| InChIKey | WGHDTBLIPPPJPM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|