C21H20N6O3 — CID 10501400
N-[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]acetamide (PubChem CID 10501400) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]acetamide.
| Compound Name | N-[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 10501400 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[2,6-bis(3-carbamimidoylphenoxy)-3-pyridinyl]acetamide |
| SMILES | [H]/N=C(\N)c1cccc(Oc2ccc(NC(C)=O)c(Oc3cccc(/C(N)=N/[H])c3)n2)c1 |
| InChI | InChI=1S/C21H20N6O3/c1-12(28)26-17-8-9-18(29-15-6-2-4-13(10-15)19(22)23)27-21(17)30-16-7-3-5-14(11-16)20(24)25/h2-11H,1H3,(H3,22,23)(H3,24,25)(H,26,28) |
| InChIKey | ZNBMRULRQJAJNW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 160.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|